C15H7I2NO3 — CID 86184565
2,4-diiodo-6-methoxy-3-oxoxanthene-9-carbonitrile (PubChem CID 86184565) has the molecular formula C15H7I2NO3 and a molecular weight of 503.03 g/mol. Its IUPAC name is 2,4-diiodo-6-methoxy-3-oxoxanthene-9-carbonitrile.
| Compound Name | 2,4-diiodo-6-methoxy-3-oxoxanthene-9-carbonitrile |
|---|---|
| PubChem CID | 86184565 |
| Molecular Formula | C15H7I2NO3 |
| Molecular Weight | 503.03 g/mol |
| Exact Mass | 502.85 |
| IUPAC Name | 2,4-diiodo-6-methoxy-3-oxoxanthene-9-carbonitrile |
| SMILES | COc1ccc2c(C#N)c3cc(I)c(=O)c(I)c-3oc2c1 |
| InChI | InChI=1S/C15H7I2NO3/c1-20-7-2-3-8-10(6-18)9-5-11(16)14(19)13(17)15(9)21-12(8)4-7/h2-5H,1H3 |
| InChIKey | GBAIYNJRUSWRQP-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 63.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.03 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|