C22H21I2NO3 — CID 86184571
2,4-diiodo-6-octoxy-3-oxoxanthene-9-carbonitrile (PubChem CID 86184571) has the molecular formula C22H21I2NO3 and a molecular weight of 601.22 g/mol. Its IUPAC name is 2,4-diiodo-6-octoxy-3-oxoxanthene-9-carbonitrile.
| Compound Name | 2,4-diiodo-6-octoxy-3-oxoxanthene-9-carbonitrile |
|---|---|
| PubChem CID | 86184571 |
| Molecular Formula | C22H21I2NO3 |
| Molecular Weight | 601.22 g/mol |
| Exact Mass | 600.96 |
| IUPAC Name | 2,4-diiodo-6-octoxy-3-oxoxanthene-9-carbonitrile |
| SMILES | CCCCCCCCOc1ccc2c(C#N)c3cc(I)c(=O)c(I)c-3oc2c1 |
| InChI | InChI=1S/C22H21I2NO3/c1-2-3-4-5-6-7-10-27-14-8-9-15-17(13-25)16-12-18(23)21(26)20(24)22(16)28-19(15)11-14/h8-9,11-12H,2-7,10H2,1H3 |
| InChIKey | CSYWWGPOHINWEG-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 63.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.22 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|