C11H9N3OS — CID 86185787
4-(furan-2-yl)-2-(1H-imidazol-5-ylmethyl)-1,3-thiazole (PubChem CID 86185787) has the molecular formula C11H9N3OS and a molecular weight of 231.28 g/mol. Its IUPAC name is 4-(furan-2-yl)-2-(1H-imidazol-5-ylmethyl)-1,3-thiazole.
| Compound Name | 4-(furan-2-yl)-2-(1H-imidazol-5-ylmethyl)-1,3-thiazole |
|---|---|
| PubChem CID | 86185787 |
| Molecular Formula | C11H9N3OS |
| Molecular Weight | 231.28 g/mol |
| Exact Mass | 231.05 |
| IUPAC Name | 4-(furan-2-yl)-2-(1H-imidazol-5-ylmethyl)-1,3-thiazole |
| SMILES | c1coc(-c2csc(Cc3cnc[nH]3)n2)c1 |
| InChI | InChI=1S/C11H9N3OS/c1-2-10(15-3-1)9-6-16-11(14-9)4-8-5-12-7-13-8/h1-3,5-7H,4H2,(H,12,13) |
| InChIKey | XXENOVJKJTWDEW-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.28 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |