C21H32O — CID 86188783
cyclohexyl-(3,4-ditert-butylphenyl)methanone (PubChem CID 86188783) has the molecular formula C21H32O and a molecular weight of 300.49 g/mol. Its IUPAC name is cyclohexyl-(3,4-ditert-butylphenyl)methanone.
| Compound Name | cyclohexyl-(3,4-ditert-butylphenyl)methanone |
|---|---|
| PubChem CID | 86188783 |
| Molecular Formula | C21H32O |
| Molecular Weight | 300.49 g/mol |
| Exact Mass | 300.25 |
| IUPAC Name | cyclohexyl-(3,4-ditert-butylphenyl)methanone |
| SMILES | CC(C)(C)c1ccc(C(=O)C2CCCCC2)cc1C(C)(C)C |
| InChI | InChI=1S/C21H32O/c1-20(2,3)17-13-12-16(14-18(17)21(4,5)6)19(22)15-10-8-7-9-11-15/h12-15H,7-11H2,1-6H3 |
| InChIKey | CLGGMXCIRUMJIU-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.49 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |