C32H26O8 — CID 86198082
1-(2,6-dihydroxy-4,7-dimethoxyphenanthren-1-yl)-4,7-dimethoxyphenanthrene-2,6-diol (PubChem CID 86198082) has the molecular formula C32H26O8 and a molecular weight of 538.55 g/mol. Its IUPAC name is 1-(2,6-dihydroxy-4,7-dimethoxyphenanthren-1-yl)-4,7-dimethoxyphenanthrene-2,6-diol.
| Compound Name | 1-(2,6-dihydroxy-4,7-dimethoxyphenanthren-1-yl)-4,7-dimethoxyphenanthrene-2,6-diol |
|---|---|
| PubChem CID | 86198082 |
| Molecular Formula | C32H26O8 |
| Molecular Weight | 538.55 g/mol |
| Exact Mass | 538.16 |
| IUPAC Name | 1-(2,6-dihydroxy-4,7-dimethoxyphenanthren-1-yl)-4,7-dimethoxyphenanthrene-2,6-diol |
| SMILES | COc1cc2ccc3c(-c4c(O)cc(OC)c5c4ccc4cc(OC)c(O)cc45)c(O)cc(OC)c3c2cc1O |
| InChI | InChI=1S/C32H26O8/c1-37-25-9-15-5-7-17-29(19(15)11-21(25)33)27(39-3)13-23(35)31(17)32-18-8-6-16-10-26(38-2)22(34)12-20(16)30(18)28(40-4)14-24(32)36/h5-14,33-36H,1-4H3 |
| InChIKey | NWBWQNGQXMTARB-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 117.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.55 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|