C21H17FN2O2 — CID 86201260
3-(4-fluorophenyl)-1,5-dipyridin-2-ylpentane-1,5-dione (PubChem CID 86201260) has the molecular formula C21H17FN2O2 and a molecular weight of 348.38 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-1,5-dipyridin-2-ylpentane-1,5-dione.
| Compound Name | 3-(4-fluorophenyl)-1,5-dipyridin-2-ylpentane-1,5-dione |
|---|---|
| PubChem CID | 86201260 |
| Molecular Formula | C21H17FN2O2 |
| Molecular Weight | 348.38 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | 3-(4-fluorophenyl)-1,5-dipyridin-2-ylpentane-1,5-dione |
| SMILES | O=C(CC(CC(=O)c1ccccn1)c1ccc(F)cc1)c1ccccn1 |
| InChI | InChI=1S/C21H17FN2O2/c22-17-9-7-15(8-10-17)16(13-20(25)18-5-1-3-11-23-18)14-21(26)19-6-2-4-12-24-19/h1-12,16H,13-14H2 |
| InChIKey | CWRZLMUUKOWCAJ-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 59.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.38 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |