C18H12N2O4 — CID 86202893
4-[4,5-bis(furan-2-yl)-1H-imidazol-2-yl]benzoic acid (PubChem CID 86202893) has the molecular formula C18H12N2O4 and a molecular weight of 320.30 g/mol. Its IUPAC name is 4-[4,5-bis(furan-2-yl)-1H-imidazol-2-yl]benzoic acid.
| Compound Name | 4-[4,5-bis(furan-2-yl)-1H-imidazol-2-yl]benzoic acid |
|---|---|
| PubChem CID | 86202893 |
| Molecular Formula | C18H12N2O4 |
| Molecular Weight | 320.30 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | 4-[4,5-bis(furan-2-yl)-1H-imidazol-2-yl]benzoic acid |
| SMILES | O=C(O)c1ccc(-c2nc(-c3ccco3)c(-c3ccco3)[nH]2)cc1 |
| InChI | InChI=1S/C18H12N2O4/c21-18(22)12-7-5-11(6-8-12)17-19-15(13-3-1-9-23-13)16(20-17)14-4-2-10-24-14/h1-10H,(H,19,20)(H,21,22) |
| InChIKey | NQCRGQHPZBANBP-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.30 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |