C20H15NO6 — CID 86207609
9-(3-nitrophenyl)-2-propan-2-ylidene-8,9-dihydrofuro[2,3-f]chromene-3,7-dione (PubChem CID 86207609) has the molecular formula C20H15NO6 and a molecular weight of 365.34 g/mol. Its IUPAC name is 9-(3-nitrophenyl)-2-propan-2-ylidene-8,9-dihydrofuro[2,3-f]chromene-3,7-dione.
| Compound Name | 9-(3-nitrophenyl)-2-propan-2-ylidene-8,9-dihydrofuro[2,3-f]chromene-3,7-dione |
|---|---|
| PubChem CID | 86207609 |
| Molecular Formula | C20H15NO6 |
| Molecular Weight | 365.34 g/mol |
| Exact Mass | 365.09 |
| IUPAC Name | 9-(3-nitrophenyl)-2-propan-2-ylidene-8,9-dihydrofuro[2,3-f]chromene-3,7-dione |
| SMILES | CC(C)=C1Oc2c(ccc3c2C(c2cccc([N+](=O)[O-])c2)CC(=O)O3)C1=O |
| InChI | InChI=1S/C20H15NO6/c1-10(2)19-18(23)13-6-7-15-17(20(13)27-19)14(9-16(22)26-15)11-4-3-5-12(8-11)21(24)25/h3-8,14H,9H2,1-2H3 |
| InChIKey | YLMTZBVMKKQZQA-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 95.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.34 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|