C8H13ClN2O — CID 86208237
[1-(2-chloroethyl)-3,5-dimethylpyrazol-4-yl]methanol (PubChem CID 86208237) has the molecular formula C8H13ClN2O and a molecular weight of 188.66 g/mol. Its IUPAC name is [1-(2-chloroethyl)-3,5-dimethylpyrazol-4-yl]methanol.
| Compound Name | [1-(2-chloroethyl)-3,5-dimethylpyrazol-4-yl]methanol |
|---|---|
| PubChem CID | 86208237 |
| Molecular Formula | C8H13ClN2O |
| Molecular Weight | 188.66 g/mol |
| Exact Mass | 188.07 |
| IUPAC Name | [1-(2-chloroethyl)-3,5-dimethylpyrazol-4-yl]methanol |
| SMILES | Cc1nn(CCCl)c(C)c1CO |
| InChI | InChI=1S/C8H13ClN2O/c1-6-8(5-12)7(2)11(10-6)4-3-9/h12H,3-5H2,1-2H3 |
| InChIKey | YBLNBAKZHIBZIE-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.66 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|