About 7,7-dimethyl-6-oxabicyclo[3.2.1]octane-1,5-dicarboxylic acid
7,7-dimethyl-6-oxabicyclo[3.2.1]octane-1,5-dicarboxylic acid (PubChem CID 86216817) has the molecular formula C11H16O5
and a molecular weight of 228.24 g/mol. Its IUPAC name is 7,7-dimethyl-6-oxabicyclo[3.2.1]octane-1,5-dicarboxylic acid.
Analyze 7,7-dimethyl-6-oxabicyclo[3.2.1]octane-1,5-dicarboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,7-dimethyl-6-oxabicyclo[3.2.1]octane-1,5-dicarboxylic acid?
The IUPAC name of 7,7-dimethyl-6-oxabicyclo[3.2.1]octane-1,5-dicarboxylic acid (CID 86216817) is 7,7-dimethyl-6-oxabicyclo[3.2.1]octane-1,5-dicarboxylic acid.
What is the SMILES notation for 7,7-dimethyl-6-oxabicyclo[3.2.1]octane-1,5-dicarboxylic acid?
The canonical SMILES for 7,7-dimethyl-6-oxabicyclo[3.2.1]octane-1,5-dicarboxylic acid is CC1(C)OC2(C(=O)O)CCCC1(C(=O)O)C2.
What is the InChIKey of 7,7-dimethyl-6-oxabicyclo[3.2.1]octane-1,5-dicarboxylic acid?
The InChIKey is YSFPXEFMBDLJBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O5/c1-9(2)10(7(12)13)4-3-5-11(6-10,16-9)8(14)15/h3-6H2,1-2H3,(H,12,13)(H,14,15).
What are the key properties of 7,7-dimethyl-6-oxabicyclo[3.2.1]octane-1,5-dicarboxylic acid?
7,7-dimethyl-6-oxabicyclo[3.2.1]octane-1,5-dicarboxylic acid has a molecular weight of 228.24 g/mol, XLogP of 1.26, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7,7-dimethyl-6-oxabicyclo[3.2.1]octane-1,5-dicarboxylic acid is sourced from PubChem (CID 86216817), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).