C12H7F13N2O — CID 86220867
2-ethoxy-5-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)pyrimidine (PubChem CID 86220867) has the molecular formula C12H7F13N2O and a molecular weight of 442.18 g/mol. Its IUPAC name is 2-ethoxy-5-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)pyrimidine.
| Compound Name | 2-ethoxy-5-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)pyrimidine |
|---|---|
| PubChem CID | 86220867 |
| Molecular Formula | C12H7F13N2O |
| Molecular Weight | 442.18 g/mol |
| Exact Mass | 442.04 |
| IUPAC Name | 2-ethoxy-5-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)pyrimidine |
| SMILES | CCOc1ncc(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cn1 |
| InChI | InChI=1S/C12H7F13N2O/c1-2-28-6-26-3-5(4-27-6)7(13,14)8(15,16)9(17,18)10(19,20)11(21,22)12(23,24)25/h3-4H,2H2,1H3 |
| InChIKey | UMUFBTCNPXMSLJ-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.18 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|