C11H14Cl2O2 — CID 86221036
1,3-bis(2-chloroethoxy)-5-methylbenzene (PubChem CID 86221036) has the molecular formula C11H14Cl2O2 and a molecular weight of 249.14 g/mol. Its IUPAC name is 1,3-bis(2-chloroethoxy)-5-methylbenzene.
| Compound Name | 1,3-bis(2-chloroethoxy)-5-methylbenzene |
|---|---|
| PubChem CID | 86221036 |
| Molecular Formula | C11H14Cl2O2 |
| Molecular Weight | 249.14 g/mol |
| Exact Mass | 248.04 |
| IUPAC Name | 1,3-bis(2-chloroethoxy)-5-methylbenzene |
| SMILES | Cc1cc(OCCCl)cc(OCCCl)c1 |
| InChI | InChI=1S/C11H14Cl2O2/c1-9-6-10(14-4-2-12)8-11(7-9)15-5-3-13/h6-8H,2-5H2,1H3 |
| InChIKey | ZLKNWEJMZGUHAZ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.14 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|