4-chloro-2-cyanopyrimidine-5-carbonyl chloride

C6HCl2N3O — CID 86223870

IUPAC4-chloro-2-cyanopyrimidine-5-carbonyl chloride
SMILESN#Cc1ncc(C(=O)Cl)c(Cl)n1
InChIInChI=1S/C6HCl2N3O/c7-5-3(6(8)12)2-10-4(1-9)11-5/h2H
InChIKeyFTTRJBLZCNNIKI-UHFFFAOYSA-N
MW202.00 g/mol
LogP1.38
Rot. Bonds1

About 4-chloro-2-cyanopyrimidine-5-carbonyl chloride

4-chloro-2-cyanopyrimidine-5-carbonyl chloride (PubChem CID 86223870) has the molecular formula C6HCl2N3O and a molecular weight of 202.00 g/mol. Its IUPAC name is 4-chloro-2-cyanopyrimidine-5-carbonyl chloride.

Molecular Properties

Compound Name4-chloro-2-cyanopyrimidine-5-carbonyl chloride
PubChem CID86223870
Molecular FormulaC6HCl2N3O
Molecular Weight202.00 g/mol
Exact Mass200.95
IUPAC Name4-chloro-2-cyanopyrimidine-5-carbonyl chloride
SMILESN#Cc1ncc(C(=O)Cl)c(Cl)n1
InChIInChI=1S/C6HCl2N3O/c7-5-3(6(8)12)2-10-4(1-9)11-5/h2H
InChIKeyFTTRJBLZCNNIKI-UHFFFAOYSA-N
XLogP1.38
TPSA66.64 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500202.00
LogP ≤ 51.38
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}

Analyze 4-chloro-2-cyanopyrimidine-5-carbonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-chloro-2-cyanopyrimidine-5-carbonyl chloride?
The IUPAC name of 4-chloro-2-cyanopyrimidine-5-carbonyl chloride (CID 86223870) is 4-chloro-2-cyanopyrimidine-5-carbonyl chloride.
What is the SMILES notation for 4-chloro-2-cyanopyrimidine-5-carbonyl chloride?
The canonical SMILES for 4-chloro-2-cyanopyrimidine-5-carbonyl chloride is N#Cc1ncc(C(=O)Cl)c(Cl)n1.
What is the InChIKey of 4-chloro-2-cyanopyrimidine-5-carbonyl chloride?
The InChIKey is FTTRJBLZCNNIKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6HCl2N3O/c7-5-3(6(8)12)2-10-4(1-9)11-5/h2H.
What are the key properties of 4-chloro-2-cyanopyrimidine-5-carbonyl chloride?
4-chloro-2-cyanopyrimidine-5-carbonyl chloride has a molecular weight of 202.00 g/mol, XLogP of 1.38, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-2-cyanopyrimidine-5-carbonyl chloride is sourced from PubChem (CID 86223870), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).