C60H48O6S6 — CID 86224623
2,3,6,7,10,11-hexakis[(4-methoxyphenyl)sulfanyl]triphenylene (PubChem CID 86224623) has the molecular formula C60H48O6S6 and a molecular weight of 1057.44 g/mol. Its IUPAC name is 2,3,6,7,10,11-hexakis[(4-methoxyphenyl)sulfanyl]triphenylene.
| Compound Name | 2,3,6,7,10,11-hexakis[(4-methoxyphenyl)sulfanyl]triphenylene |
|---|---|
| PubChem CID | 86224623 |
| Molecular Formula | C60H48O6S6 |
| Molecular Weight | 1057.44 g/mol |
| Exact Mass | 1056.18 |
| IUPAC Name | 2,3,6,7,10,11-hexakis[(4-methoxyphenyl)sulfanyl]triphenylene |
| SMILES | COc1ccc(Sc2cc3c4cc(Sc5ccc(OC)cc5)c(Sc5ccc(OC)cc5)cc4c4cc(Sc5ccc(OC)cc5)c(Sc5ccc(OC)cc5)cc4c3cc2Sc2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C60H48O6S6/c1-61-37-7-19-43(20-8-37)67-55-31-49-50(32-56(55)68-44-21-9-38(62-2)10-22-44)52-34-58(70-46-25-13-40(64-4)14-26-46)60(72-48-29-17-42(66-6)18-30-48)36-54(52)53-35-59(71-47-27-15-41(65-5)16-28-47)57(33-51(49)53)69-45-23-11-39(63-3)12-24-45/h7-36H,1-6H3 |
| InChIKey | FYSAFXMLWPKADN-UHFFFAOYSA-N |
| XLogP | 18.10 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 72 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1057.44 |
| LogP ≤ 5 | 18.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|