C33H21FO3S — CID 150076628
3-[4-[(3-fluorophenyl)methoxy]phenyl]sulfonylperylene (PubChem CID 150076628) has the molecular formula C33H21FO3S and a molecular weight of 516.59 g/mol. Its IUPAC name is 3-[4-[(3-fluorophenyl)methoxy]phenyl]sulfonylperylene.
| Compound Name | 3-[4-[(3-fluorophenyl)methoxy]phenyl]sulfonylperylene |
|---|---|
| PubChem CID | 150076628 |
| Molecular Formula | C33H21FO3S |
| Molecular Weight | 516.59 g/mol |
| Exact Mass | 516.12 |
| IUPAC Name | 3-[4-[(3-fluorophenyl)methoxy]phenyl]sulfonylperylene |
| SMILES | O=S(=O)(c1ccc(OCc2cccc(F)c2)cc1)c1ccc2c3cccc4cccc(c5cccc1c52)c43 |
| InChI | InChI=1S/C33H21FO3S/c34-23-8-1-5-21(19-23)20-37-24-13-15-25(16-14-24)38(35,36)31-18-17-29-27-10-3-7-22-6-2-9-26(32(22)27)28-11-4-12-30(31)33(28)29/h1-19H,20H2 |
| InChIKey | DQKBWBSXACKJDN-UHFFFAOYSA-N |
| XLogP | 8.29 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.59 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|