C20H39B — CID 86227091
dibutyl(dodeca-5,6-dien-5-yl)borane (PubChem CID 86227091) has the molecular formula C20H39B and a molecular weight of 290.34 g/mol. Its IUPAC name is dibutyl(dodeca-5,6-dien-5-yl)borane.
| Compound Name | dibutyl(dodeca-5,6-dien-5-yl)borane |
|---|---|
| PubChem CID | 86227091 |
| Molecular Formula | C20H39B |
| Molecular Weight | 290.34 g/mol |
| Exact Mass | 290.31 |
| IUPAC Name | dibutyl(dodeca-5,6-dien-5-yl)borane |
| SMILES | CCCCCC=C=C(CCCC)B(CCCC)CCCC |
| InChI | InChI=1S/C20H39B/c1-5-9-13-14-15-17-20(16-10-6-2)21(18-11-7-3)19-12-8-4/h15H,5-14,16,18-19H2,1-4H3 |
| InChIKey | KXWAXGPTSRGPNT-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 14 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.34 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|