About dihexyl(nona-1,2-dien-3-yl)borane
dihexyl(nona-1,2-dien-3-yl)borane (PubChem CID 86230776) has the molecular formula C21H41B
and a molecular weight of 304.37 g/mol. Its IUPAC name is dihexyl(nona-1,2-dien-3-yl)borane.
Molecular Properties
| Compound Name | dihexyl(nona-1,2-dien-3-yl)borane |
| PubChem CID | 86230776 |
| Molecular Formula | C21H41B |
| Molecular Weight | 304.37 g/mol |
| Exact Mass | 304.33 |
| IUPAC Name | dihexyl(nona-1,2-dien-3-yl)borane |
| SMILES | C=C=C(CCCCCC)B(CCCCCC)CCCCCC |
| InChI | InChI=1S/C21H41B/c1-5-9-12-15-18-21(8-4)22(19-16-13-10-6-2)20-17-14-11-7-3/h4-7,9-20H2,1-3H3 |
| InChIKey | GCOUCEKNFBGMRN-UHFFFAOYSA-N |
| XLogP | 7.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 16 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 304.37 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze dihexyl(nona-1,2-dien-3-yl)borane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dihexyl(nona-1,2-dien-3-yl)borane?
The IUPAC name of dihexyl(nona-1,2-dien-3-yl)borane (CID 86230776) is dihexyl(nona-1,2-dien-3-yl)borane.
What is the SMILES notation for dihexyl(nona-1,2-dien-3-yl)borane?
The canonical SMILES for dihexyl(nona-1,2-dien-3-yl)borane is C=C=C(CCCCCC)B(CCCCCC)CCCCCC.
What is the InChIKey of dihexyl(nona-1,2-dien-3-yl)borane?
The InChIKey is GCOUCEKNFBGMRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H41B/c1-5-9-12-15-18-21(8-4)22(19-16-13-10-6-2)20-17-14-11-7-3/h4-7,9-20H2,1-3H3.
What are the key properties of dihexyl(nona-1,2-dien-3-yl)borane?
dihexyl(nona-1,2-dien-3-yl)borane has a molecular weight of 304.37 g/mol, XLogP of 7.86, 16 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dihexyl(nona-1,2-dien-3-yl)borane is sourced from PubChem (CID 86230776), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).