About octa-1,2-dien-3-yl(dipentyl)borane
octa-1,2-dien-3-yl(dipentyl)borane (PubChem CID 25098675) has the molecular formula C18H35B
and a molecular weight of 262.29 g/mol. Its IUPAC name is octa-1,2-dien-3-yl(dipentyl)borane.
Molecular Properties
| Compound Name | octa-1,2-dien-3-yl(dipentyl)borane |
| PubChem CID | 25098675 |
| Molecular Formula | C18H35B |
| Molecular Weight | 262.29 g/mol |
| Exact Mass | 262.28 |
| IUPAC Name | octa-1,2-dien-3-yl(dipentyl)borane |
| SMILES | C=C=C(CCCCC)B(CCCCC)CCCCC |
| InChI | InChI=1S/C18H35B/c1-5-9-12-15-18(8-4)19(16-13-10-6-2)17-14-11-7-3/h4-7,9-17H2,1-3H3 |
| InChIKey | ZFIKFFCCQTVNLN-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 13 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 262.29 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze octa-1,2-dien-3-yl(dipentyl)borane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of octa-1,2-dien-3-yl(dipentyl)borane?
The IUPAC name of octa-1,2-dien-3-yl(dipentyl)borane (CID 25098675) is octa-1,2-dien-3-yl(dipentyl)borane.
What is the SMILES notation for octa-1,2-dien-3-yl(dipentyl)borane?
The canonical SMILES for octa-1,2-dien-3-yl(dipentyl)borane is C=C=C(CCCCC)B(CCCCC)CCCCC.
What is the InChIKey of octa-1,2-dien-3-yl(dipentyl)borane?
The InChIKey is ZFIKFFCCQTVNLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H35B/c1-5-9-12-15-18(8-4)19(16-13-10-6-2)17-14-11-7-3/h4-7,9-17H2,1-3H3.
What are the key properties of octa-1,2-dien-3-yl(dipentyl)borane?
octa-1,2-dien-3-yl(dipentyl)borane has a molecular weight of 262.29 g/mol, XLogP of 6.69, 13 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for octa-1,2-dien-3-yl(dipentyl)borane is sourced from PubChem (CID 25098675), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).