C20H40Sn — CID 11418130
tributyl(octa-1,2-dien-3-yl)stannane (PubChem CID 11418130) has the molecular formula C20H40Sn and a molecular weight of 399.25 g/mol. Its IUPAC name is tributyl(octa-1,2-dien-3-yl)stannane.
| Compound Name | tributyl(octa-1,2-dien-3-yl)stannane |
|---|---|
| PubChem CID | 11418130 |
| Molecular Formula | C20H40Sn |
| Molecular Weight | 399.25 g/mol |
| Exact Mass | 400.22 |
| IUPAC Name | tributyl(octa-1,2-dien-3-yl)stannane |
| SMILES | C=C=C(CCCCC)[Sn](CCCC)(CCCC)CCCC |
| InChI | InChI=1S/C8H13.3C4H9.Sn/c1-3-5-7-8-6-4-2;3*1-3-4-2;/h1,4,6-8H2,2H3;3*1,3-4H2,2H3; |
| InChIKey | OUBOJVNYMRJZCH-UHFFFAOYSA-N |
| XLogP | 7.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 14 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.25 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|