C12H18O2 — CID 86228817
2-cyclohexyl-5-methyl-2,3-dihydropyran-4-one (PubChem CID 86228817) has the molecular formula C12H18O2 and a molecular weight of 194.27 g/mol. Its IUPAC name is 2-cyclohexyl-5-methyl-2,3-dihydropyran-4-one.
| Compound Name | 2-cyclohexyl-5-methyl-2,3-dihydropyran-4-one |
|---|---|
| PubChem CID | 86228817 |
| Molecular Formula | C12H18O2 |
| Molecular Weight | 194.27 g/mol |
| Exact Mass | 194.13 |
| IUPAC Name | 2-cyclohexyl-5-methyl-2,3-dihydropyran-4-one |
| SMILES | CC1=COC(C2CCCCC2)CC1=O |
| InChI | InChI=1S/C12H18O2/c1-9-8-14-12(7-11(9)13)10-5-3-2-4-6-10/h8,10,12H,2-7H2,1H3 |
| InChIKey | YJBZIIKIDQUMNO-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.27 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |