C10H19BrF2O2S — CID 86233117
2-bromo-1,1-difluoro-1-methylsulfonylnonane (PubChem CID 86233117) has the molecular formula C10H19BrF2O2S and a molecular weight of 321.23 g/mol. Its IUPAC name is 2-bromo-1,1-difluoro-1-methylsulfonylnonane.
| Compound Name | 2-bromo-1,1-difluoro-1-methylsulfonylnonane |
|---|---|
| PubChem CID | 86233117 |
| Molecular Formula | C10H19BrF2O2S |
| Molecular Weight | 321.23 g/mol |
| Exact Mass | 320.03 |
| IUPAC Name | 2-bromo-1,1-difluoro-1-methylsulfonylnonane |
| SMILES | CCCCCCCC(Br)C(F)(F)S(C)(=O)=O |
| InChI | InChI=1S/C10H19BrF2O2S/c1-3-4-5-6-7-8-9(11)10(12,13)16(2,14)15/h9H,3-8H2,1-2H3 |
| InChIKey | QEWKWCYQEWLOKY-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.23 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|