C27H50OSi2 — CID 86233962
5,5-bis(2-triethylsilylethynyl)undecan-6-one (PubChem CID 86233962) has the molecular formula C27H50OSi2 and a molecular weight of 446.87 g/mol. Its IUPAC name is 5,5-bis(2-triethylsilylethynyl)undecan-6-one.
| Compound Name | 5,5-bis(2-triethylsilylethynyl)undecan-6-one |
|---|---|
| PubChem CID | 86233962 |
| Molecular Formula | C27H50OSi2 |
| Molecular Weight | 446.87 g/mol |
| Exact Mass | 446.34 |
| IUPAC Name | 5,5-bis(2-triethylsilylethynyl)undecan-6-one |
| SMILES | CCCCCC(=O)C(C#C[Si](CC)(CC)CC)(C#C[Si](CC)(CC)CC)CCCC |
| InChI | InChI=1S/C27H50OSi2/c1-9-17-19-20-26(28)27(21-18-10-2,22-24-29(11-3,12-4)13-5)23-25-30(14-6,15-7)16-8/h9-21H2,1-8H3 |
| InChIKey | MSCTWGCNFXMJQM-UHFFFAOYSA-N |
| XLogP | 8.41 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.87 |
| LogP ≤ 5 | 8.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|