C22H44OSi2 — CID 91425086
1,2-bis[tert-butyl(dimethyl)silyl]-4,4-dimethyloct-7-yn-1-one (PubChem CID 91425086) has the molecular formula C22H44OSi2 and a molecular weight of 380.77 g/mol. Its IUPAC name is 1,2-bis[tert-butyl(dimethyl)silyl]-4,4-dimethyloct-7-yn-1-one.
| Compound Name | 1,2-bis[tert-butyl(dimethyl)silyl]-4,4-dimethyloct-7-yn-1-one |
|---|---|
| PubChem CID | 91425086 |
| Molecular Formula | C22H44OSi2 |
| Molecular Weight | 380.77 g/mol |
| Exact Mass | 380.29 |
| IUPAC Name | 1,2-bis[tert-butyl(dimethyl)silyl]-4,4-dimethyloct-7-yn-1-one |
| SMILES | C#CCCC(C)(C)CC(C(=O)[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H44OSi2/c1-14-15-16-22(8,9)17-18(24(10,11)20(2,3)4)19(23)25(12,13)21(5,6)7/h1,18H,15-17H2,2-13H3 |
| InChIKey | IDEAWQSHKJCTEG-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.77 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|