C22H38OSi2 — CID 86233970
2,2-bis(2-triethylsilylethynyl)cyclohexan-1-one (PubChem CID 86233970) has the molecular formula C22H38OSi2 and a molecular weight of 374.72 g/mol. Its IUPAC name is 2,2-bis(2-triethylsilylethynyl)cyclohexan-1-one.
| Compound Name | 2,2-bis(2-triethylsilylethynyl)cyclohexan-1-one |
|---|---|
| PubChem CID | 86233970 |
| Molecular Formula | C22H38OSi2 |
| Molecular Weight | 374.72 g/mol |
| Exact Mass | 374.25 |
| IUPAC Name | 2,2-bis(2-triethylsilylethynyl)cyclohexan-1-one |
| SMILES | CC[Si](C#CC1(C#C[Si](CC)(CC)CC)CCCCC1=O)(CC)CC |
| InChI | InChI=1S/C22H38OSi2/c1-7-24(8-2,9-3)19-17-22(16-14-13-15-21(22)23)18-20-25(10-4,11-5)12-6/h7-16H2,1-6H3 |
| InChIKey | HYYCWFGAOOJDSD-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.72 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|