C17H19ClO4 — CID 86234246
5-[1-(4-chlorophenyl)pentylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione (PubChem CID 86234246) has the molecular formula C17H19ClO4 and a molecular weight of 322.79 g/mol. Its IUPAC name is 5-[1-(4-chlorophenyl)pentylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione.
| Compound Name | 5-[1-(4-chlorophenyl)pentylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 86234246 |
| Molecular Formula | C17H19ClO4 |
| Molecular Weight | 322.79 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | 5-[1-(4-chlorophenyl)pentylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione |
| SMILES | CCCCC(=C1C(=O)OC(C)(C)OC1=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H19ClO4/c1-4-5-6-13(11-7-9-12(18)10-8-11)14-15(19)21-17(2,3)22-16(14)20/h7-10H,4-6H2,1-3H3 |
| InChIKey | ZGZFBIBOBAUPHU-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.79 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|