C8H16Cl3N3O3S — CID 86235569
2,2,2-trichloroethyl N-(N'-pentylcarbamimidoyl)sulfamate (PubChem CID 86235569) has the molecular formula C8H16Cl3N3O3S and a molecular weight of 340.66 g/mol. Its IUPAC name is 2,2,2-trichloroethyl N-(N'-pentylcarbamimidoyl)sulfamate.
| Compound Name | 2,2,2-trichloroethyl N-(N'-pentylcarbamimidoyl)sulfamate |
|---|---|
| PubChem CID | 86235569 |
| Molecular Formula | C8H16Cl3N3O3S |
| Molecular Weight | 340.66 g/mol |
| Exact Mass | 339.00 |
| IUPAC Name | 2,2,2-trichloroethyl N-(N'-pentylcarbamimidoyl)sulfamate |
| SMILES | CCCCC/N=C(\N)NS(=O)(=O)OCC(Cl)(Cl)Cl |
| InChI | InChI=1S/C8H16Cl3N3O3S/c1-2-3-4-5-13-7(12)14-18(15,16)17-6-8(9,10)11/h2-6H2,1H3,(H3,12,13,14) |
| InChIKey | CHXJFXFQXSASTA-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.66 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|