C14H14OS — CID 86252157
4a-methyl-3,4-dihydro-2H-thioxanthen-1-one (PubChem CID 86252157) has the molecular formula C14H14OS and a molecular weight of 230.33 g/mol. Its IUPAC name is 4a-methyl-3,4-dihydro-2H-thioxanthen-1-one.
| Compound Name | 4a-methyl-3,4-dihydro-2H-thioxanthen-1-one |
|---|---|
| PubChem CID | 86252157 |
| Molecular Formula | C14H14OS |
| Molecular Weight | 230.33 g/mol |
| Exact Mass | 230.08 |
| IUPAC Name | 4a-methyl-3,4-dihydro-2H-thioxanthen-1-one |
| SMILES | CC12CCCC(=O)C1=Cc1ccccc1S2 |
| InChI | InChI=1S/C14H14OS/c1-14-8-4-6-12(15)11(14)9-10-5-2-3-7-13(10)16-14/h2-3,5,7,9H,4,6,8H2,1H3 |
| InChIKey | FZZYWWNPBYMOIA-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.33 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |