C11H24Si — CID 86258104
trimethyl(2,3,3-trimethylpent-4-en-2-yl)silane (PubChem CID 86258104) has the molecular formula C11H24Si and a molecular weight of 184.40 g/mol. Its IUPAC name is trimethyl(2,3,3-trimethylpent-4-en-2-yl)silane.
| Compound Name | trimethyl(2,3,3-trimethylpent-4-en-2-yl)silane |
|---|---|
| PubChem CID | 86258104 |
| Molecular Formula | C11H24Si |
| Molecular Weight | 184.40 g/mol |
| Exact Mass | 184.16 |
| IUPAC Name | trimethyl(2,3,3-trimethylpent-4-en-2-yl)silane |
| SMILES | C=CC(C)(C)C(C)(C)[Si](C)(C)C |
| InChI | InChI=1S/C11H24Si/c1-9-10(2,3)11(4,5)12(6,7)8/h9H,1H2,2-8H3 |
| InChIKey | WQERCBDGKLCIEH-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.40 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|