C5H7Cl3O — CID 86259327
2-(1,2,2-trichloroethenoxy)propane (PubChem CID 86259327) has the molecular formula C5H7Cl3O and a molecular weight of 189.47 g/mol. Its IUPAC name is 2-(1,2,2-trichloroethenoxy)propane.
| Compound Name | 2-(1,2,2-trichloroethenoxy)propane |
|---|---|
| PubChem CID | 86259327 |
| Molecular Formula | C5H7Cl3O |
| Molecular Weight | 189.47 g/mol |
| Exact Mass | 187.96 |
| IUPAC Name | 2-(1,2,2-trichloroethenoxy)propane |
| SMILES | CC(C)OC(Cl)=C(Cl)Cl |
| InChI | InChI=1S/C5H7Cl3O/c1-3(2)9-5(8)4(6)7/h3H,1-2H3 |
| InChIKey | KEWPBLDQGYPYQA-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.47 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|