C26H34O2 — CID 86259576
1,5-bis(but-3-enoxy)-2,4-bis(hex-1-ynyl)benzene (PubChem CID 86259576) has the molecular formula C26H34O2 and a molecular weight of 378.56 g/mol. Its IUPAC name is 1,5-bis(but-3-enoxy)-2,4-bis(hex-1-ynyl)benzene.
| Compound Name | 1,5-bis(but-3-enoxy)-2,4-bis(hex-1-ynyl)benzene |
|---|---|
| PubChem CID | 86259576 |
| Molecular Formula | C26H34O2 |
| Molecular Weight | 378.56 g/mol |
| Exact Mass | 378.26 |
| IUPAC Name | 1,5-bis(but-3-enoxy)-2,4-bis(hex-1-ynyl)benzene |
| SMILES | C=CCCOc1cc(OCCC=C)c(C#CCCCC)cc1C#CCCCC |
| InChI | InChI=1S/C26H34O2/c1-5-9-13-15-17-23-21-24(18-16-14-10-6-2)26(28-20-12-8-4)22-25(23)27-19-11-7-3/h7-8,21-22H,3-6,9-14,19-20H2,1-2H3 |
| InChIKey | MHRPOHQDQSSMNC-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.56 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|