C22H24N2 — CID 10591528
4,5-bis(hept-1-ynyl)benzene-1,2-dicarbonitrile (PubChem CID 10591528) has the molecular formula C22H24N2 and a molecular weight of 316.45 g/mol. Its IUPAC name is 4,5-bis(hept-1-ynyl)benzene-1,2-dicarbonitrile.
| Compound Name | 4,5-bis(hept-1-ynyl)benzene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 10591528 |
| Molecular Formula | C22H24N2 |
| Molecular Weight | 316.45 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | 4,5-bis(hept-1-ynyl)benzene-1,2-dicarbonitrile |
| SMILES | CCCCCC#Cc1cc(C#N)c(C#N)cc1C#CCCCCC |
| InChI | InChI=1S/C22H24N2/c1-3-5-7-9-11-13-19-15-21(17-23)22(18-24)16-20(19)14-12-10-8-6-4-2/h15-16H,3-10H2,1-2H3 |
| InChIKey | JNCKRKUVIMXKHO-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.45 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|