C16H23N — CID 86095171
4,5-dimethyl-2-oct-1-ynylaniline (PubChem CID 86095171) has the molecular formula C16H23N and a molecular weight of 229.37 g/mol. Its IUPAC name is 4,5-dimethyl-2-oct-1-ynylaniline.
| Compound Name | 4,5-dimethyl-2-oct-1-ynylaniline |
|---|---|
| PubChem CID | 86095171 |
| Molecular Formula | C16H23N |
| Molecular Weight | 229.37 g/mol |
| Exact Mass | 229.18 |
| IUPAC Name | 4,5-dimethyl-2-oct-1-ynylaniline |
| SMILES | CCCCCCC#Cc1cc(C)c(C)cc1N |
| InChI | InChI=1S/C16H23N/c1-4-5-6-7-8-9-10-15-11-13(2)14(3)12-16(15)17/h11-12H,4-8,17H2,1-3H3 |
| InChIKey | JDFJUVBFIFHYJA-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.37 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|