C17H25N — CID 11564991
N,N,4-trimethyl-2-oct-1-ynylaniline (PubChem CID 11564991) has the molecular formula C17H25N and a molecular weight of 243.39 g/mol. Its IUPAC name is N,N,4-trimethyl-2-oct-1-ynylaniline.
| Compound Name | N,N,4-trimethyl-2-oct-1-ynylaniline |
|---|---|
| PubChem CID | 11564991 |
| Molecular Formula | C17H25N |
| Molecular Weight | 243.39 g/mol |
| Exact Mass | 243.20 |
| IUPAC Name | N,N,4-trimethyl-2-oct-1-ynylaniline |
| SMILES | CCCCCCC#Cc1cc(C)ccc1N(C)C |
| InChI | InChI=1S/C17H25N/c1-5-6-7-8-9-10-11-16-14-15(2)12-13-17(16)18(3)4/h12-14H,5-9H2,1-4H3 |
| InChIKey | ZFCRICUBUPMPJY-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.39 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|