C14H19N — CID 135086230
2-hex-1-ynyl-N,4-dimethylaniline (PubChem CID 135086230) has the molecular formula C14H19N and a molecular weight of 201.31 g/mol. Its IUPAC name is 2-hex-1-ynyl-N,4-dimethylaniline.
| Compound Name | 2-hex-1-ynyl-N,4-dimethylaniline |
|---|---|
| PubChem CID | 135086230 |
| Molecular Formula | C14H19N |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.15 |
| IUPAC Name | 2-hex-1-ynyl-N,4-dimethylaniline |
| SMILES | CCCCC#Cc1cc(C)ccc1NC |
| InChI | InChI=1S/C14H19N/c1-4-5-6-7-8-13-11-12(2)9-10-14(13)15-3/h9-11,15H,4-6H2,1-3H3 |
| InChIKey | GNFMXGPAKIUOJK-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|