C20H27N — CID 53247750
2-dodeca-1,3-diynyl-N,N-dimethylaniline (PubChem CID 53247750) has the molecular formula C20H27N and a molecular weight of 281.44 g/mol. Its IUPAC name is 2-dodeca-1,3-diynyl-N,N-dimethylaniline.
| Compound Name | 2-dodeca-1,3-diynyl-N,N-dimethylaniline |
|---|---|
| PubChem CID | 53247750 |
| Molecular Formula | C20H27N |
| Molecular Weight | 281.44 g/mol |
| Exact Mass | 281.21 |
| IUPAC Name | 2-dodeca-1,3-diynyl-N,N-dimethylaniline |
| SMILES | CCCCCCCCC#CC#Cc1ccccc1N(C)C |
| InChI | InChI=1S/C20H27N/c1-4-5-6-7-8-9-10-11-12-13-16-19-17-14-15-18-20(19)21(2)3/h14-15,17-18H,4-10H2,1-3H3 |
| InChIKey | KYIPAOOLPJVNNW-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.44 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|