C16H22N2O — CID 90552073
N-[3-[2-(dimethylamino)phenyl]prop-2-ynyl]pentanamide (PubChem CID 90552073) has the molecular formula C16H22N2O and a molecular weight of 258.37 g/mol. Its IUPAC name is N-[3-[2-(dimethylamino)phenyl]prop-2-ynyl]pentanamide.
| Compound Name | N-[3-[2-(dimethylamino)phenyl]prop-2-ynyl]pentanamide |
|---|---|
| PubChem CID | 90552073 |
| Molecular Formula | C16H22N2O |
| Molecular Weight | 258.37 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | N-[3-[2-(dimethylamino)phenyl]prop-2-ynyl]pentanamide |
| SMILES | CCCCC(=O)NCC#Cc1ccccc1N(C)C |
| InChI | InChI=1S/C16H22N2O/c1-4-5-12-16(19)17-13-8-10-14-9-6-7-11-15(14)18(2)3/h6-7,9,11H,4-5,12-13H2,1-3H3,(H,17,19) |
| InChIKey | SUSUOJDEJXNHGG-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.37 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|