C22H27N3O3S — CID 90552189
4-(diethylsulfamoyl)-N-[3-[2-(dimethylamino)phenyl]prop-2-ynyl]benzamide (PubChem CID 90552189) has the molecular formula C22H27N3O3S and a molecular weight of 413.54 g/mol. Its IUPAC name is 4-(diethylsulfamoyl)-N-[3-[2-(dimethylamino)phenyl]prop-2-ynyl]benzamide.
| Compound Name | 4-(diethylsulfamoyl)-N-[3-[2-(dimethylamino)phenyl]prop-2-ynyl]benzamide |
|---|---|
| PubChem CID | 90552189 |
| Molecular Formula | C22H27N3O3S |
| Molecular Weight | 413.54 g/mol |
| Exact Mass | 413.18 |
| IUPAC Name | 4-(diethylsulfamoyl)-N-[3-[2-(dimethylamino)phenyl]prop-2-ynyl]benzamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(C(=O)NCC#Cc2ccccc2N(C)C)cc1 |
| InChI | InChI=1S/C22H27N3O3S/c1-5-25(6-2)29(27,28)20-15-13-19(14-16-20)22(26)23-17-9-11-18-10-7-8-12-21(18)24(3)4/h7-8,10,12-16H,5-6,17H2,1-4H3,(H,23,26) |
| InChIKey | BQVDKYQAOWDBLJ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.54 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|