C24H22N2O — CID 90552151
N-[3-[2-(dimethylamino)phenyl]prop-2-ynyl]-4-phenylbenzamide (PubChem CID 90552151) has the molecular formula C24H22N2O and a molecular weight of 354.45 g/mol. Its IUPAC name is N-[3-[2-(dimethylamino)phenyl]prop-2-ynyl]-4-phenylbenzamide.
| Compound Name | N-[3-[2-(dimethylamino)phenyl]prop-2-ynyl]-4-phenylbenzamide |
|---|---|
| PubChem CID | 90552151 |
| Molecular Formula | C24H22N2O |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | N-[3-[2-(dimethylamino)phenyl]prop-2-ynyl]-4-phenylbenzamide |
| SMILES | CN(C)c1ccccc1C#CCNC(=O)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C24H22N2O/c1-26(2)23-13-7-6-11-21(23)12-8-18-25-24(27)22-16-14-20(15-17-22)19-9-4-3-5-10-19/h3-7,9-11,13-17H,18H2,1-2H3,(H,25,27) |
| InChIKey | NAODZQVJYRAKBY-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|