C16H21Cl2N — CID 102575189
2,4-dichloro-6-dec-1-ynylaniline (PubChem CID 102575189) has the molecular formula C16H21Cl2N and a molecular weight of 298.26 g/mol. Its IUPAC name is 2,4-dichloro-6-dec-1-ynylaniline.
| Compound Name | 2,4-dichloro-6-dec-1-ynylaniline |
|---|---|
| PubChem CID | 102575189 |
| Molecular Formula | C16H21Cl2N |
| Molecular Weight | 298.26 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | 2,4-dichloro-6-dec-1-ynylaniline |
| SMILES | CCCCCCCCC#Cc1cc(Cl)cc(Cl)c1N |
| InChI | InChI=1S/C16H21Cl2N/c1-2-3-4-5-6-7-8-9-10-13-11-14(17)12-15(18)16(13)19/h11-12H,2-8,19H2,1H3 |
| InChIKey | AJWBDBYDTHUTSS-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.26 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|