C12H18N4 — CID 86263335
2-pyrrolidin-1-yl-5,6,7,8-tetrahydroquinazolin-6-amine (PubChem CID 86263335) has the molecular formula C12H18N4 and a molecular weight of 218.30 g/mol. Its IUPAC name is 2-pyrrolidin-1-yl-5,6,7,8-tetrahydroquinazolin-6-amine.
| Compound Name | 2-pyrrolidin-1-yl-5,6,7,8-tetrahydroquinazolin-6-amine |
|---|---|
| PubChem CID | 86263335 |
| Molecular Formula | C12H18N4 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.15 |
| IUPAC Name | 2-pyrrolidin-1-yl-5,6,7,8-tetrahydroquinazolin-6-amine |
| SMILES | NC1CCc2nc(N3CCCC3)ncc2C1 |
| InChI | InChI=1S/C12H18N4/c13-10-3-4-11-9(7-10)8-14-12(15-11)16-5-1-2-6-16/h8,10H,1-7,13H2 |
| InChIKey | BDPZIHJGNSROTJ-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |