C12H18N4O — CID 28820466
(6R)-2-morpholin-4-yl-5,6,7,8-tetrahydroquinazolin-6-amine (PubChem CID 28820466) has the molecular formula C12H18N4O and a molecular weight of 234.30 g/mol. Its IUPAC name is (6R)-2-morpholin-4-yl-5,6,7,8-tetrahydroquinazolin-6-amine.
| Compound Name | (6R)-2-morpholin-4-yl-5,6,7,8-tetrahydroquinazolin-6-amine |
|---|---|
| PubChem CID | 28820466 |
| Molecular Formula | C12H18N4O |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.15 |
| IUPAC Name | (6R)-2-morpholin-4-yl-5,6,7,8-tetrahydroquinazolin-6-amine |
| SMILES | N[C@@H]1CCc2nc(N3CCOCC3)ncc2C1 |
| InChI | InChI=1S/C12H18N4O/c13-10-1-2-11-9(7-10)8-14-12(15-11)16-3-5-17-6-4-16/h8,10H,1-7,13H2/t10-/m1/s1 |
| InChIKey | IOLVDEHYEZMUIO-SNVBAGLBSA-N |
| XLogP | 0.13 |
| TPSA | 64.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |