C24H33N5O2 — CID 95112148
(6R)-N-[[4-(diethylamino)phenyl]methyl]-2-morpholin-4-yl-5,6,7,8-tetrahydroquinazoline-6-carboxamide (PubChem CID 95112148) has the molecular formula C24H33N5O2 and a molecular weight of 423.56 g/mol. Its IUPAC name is (6R)-N-[[4-(diethylamino)phenyl]methyl]-2-morpholin-4-yl-5,6,7,8-tetrahydroquinazoline-6-carboxamide.
| Compound Name | (6R)-N-[[4-(diethylamino)phenyl]methyl]-2-morpholin-4-yl-5,6,7,8-tetrahydroquinazoline-6-carboxamide |
|---|---|
| PubChem CID | 95112148 |
| Molecular Formula | C24H33N5O2 |
| Molecular Weight | 423.56 g/mol |
| Exact Mass | 423.26 |
| IUPAC Name | (6R)-N-[[4-(diethylamino)phenyl]methyl]-2-morpholin-4-yl-5,6,7,8-tetrahydroquinazoline-6-carboxamide |
| SMILES | CCN(CC)c1ccc(CNC(=O)[C@@H]2CCc3nc(N4CCOCC4)ncc3C2)cc1 |
| InChI | InChI=1S/C24H33N5O2/c1-3-28(4-2)21-8-5-18(6-9-21)16-25-23(30)19-7-10-22-20(15-19)17-26-24(27-22)29-11-13-31-14-12-29/h5-6,8-9,17,19H,3-4,7,10-16H2,1-2H3,(H,25,30)/t19-/m1/s1 |
| InChIKey | WHJYYZMUTONSHU-LJQANCHMSA-N |
| XLogP | 2.58 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.56 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|