C25H35N5O — CID 95112007
(6S)-N-[[4-(diethylamino)phenyl]methyl]-2-piperidin-1-yl-5,6,7,8-tetrahydroquinazoline-6-carboxamide (PubChem CID 95112007) has the molecular formula C25H35N5O and a molecular weight of 421.59 g/mol. Its IUPAC name is (6S)-N-[[4-(diethylamino)phenyl]methyl]-2-piperidin-1-yl-5,6,7,8-tetrahydroquinazoline-6-carboxamide.
| Compound Name | (6S)-N-[[4-(diethylamino)phenyl]methyl]-2-piperidin-1-yl-5,6,7,8-tetrahydroquinazoline-6-carboxamide |
|---|---|
| PubChem CID | 95112007 |
| Molecular Formula | C25H35N5O |
| Molecular Weight | 421.59 g/mol |
| Exact Mass | 421.28 |
| IUPAC Name | (6S)-N-[[4-(diethylamino)phenyl]methyl]-2-piperidin-1-yl-5,6,7,8-tetrahydroquinazoline-6-carboxamide |
| SMILES | CCN(CC)c1ccc(CNC(=O)[C@H]2CCc3nc(N4CCCCC4)ncc3C2)cc1 |
| InChI | InChI=1S/C25H35N5O/c1-3-29(4-2)22-11-8-19(9-12-22)17-26-24(31)20-10-13-23-21(16-20)18-27-25(28-23)30-14-6-5-7-15-30/h8-9,11-12,18,20H,3-7,10,13-17H2,1-2H3,(H,26,31)/t20-/m0/s1 |
| InChIKey | NFMCLHXAZKBAFS-FQEVSTJZSA-N |
| XLogP | 3.73 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.59 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|