C26H35N5O — CID 95112000
(6R)-N-[3-(3,4-dihydro-2H-quinolin-1-yl)propyl]-2-piperidin-1-yl-5,6,7,8-tetrahydroquinazoline-6-carboxamide (PubChem CID 95112000) has the molecular formula C26H35N5O and a molecular weight of 433.60 g/mol. Its IUPAC name is (6R)-N-[3-(3,4-dihydro-2H-quinolin-1-yl)propyl]-2-piperidin-1-yl-5,6,7,8-tetrahydroquinazoline-6-carboxamide.
| Compound Name | (6R)-N-[3-(3,4-dihydro-2H-quinolin-1-yl)propyl]-2-piperidin-1-yl-5,6,7,8-tetrahydroquinazoline-6-carboxamide |
|---|---|
| PubChem CID | 95112000 |
| Molecular Formula | C26H35N5O |
| Molecular Weight | 433.60 g/mol |
| Exact Mass | 433.28 |
| IUPAC Name | (6R)-N-[3-(3,4-dihydro-2H-quinolin-1-yl)propyl]-2-piperidin-1-yl-5,6,7,8-tetrahydroquinazoline-6-carboxamide |
| SMILES | O=C(NCCCN1CCCc2ccccc21)[C@@H]1CCc2nc(N3CCCCC3)ncc2C1 |
| InChI | InChI=1S/C26H35N5O/c32-25(27-13-7-17-30-16-6-9-20-8-2-3-10-24(20)30)21-11-12-23-22(18-21)19-28-26(29-23)31-14-4-1-5-15-31/h2-3,8,10,19,21H,1,4-7,9,11-18H2,(H,27,32)/t21-/m1/s1 |
| InChIKey | HWZBSGMGMAZPIL-OAQYLSRUSA-N |
| XLogP | 3.53 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.60 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|