C24H30N6O — CID 53203069
N-[3-(3,4-dihydro-2H-quinolin-1-yl)propyl]-1-([1,2,4]triazolo[4,3-a]pyridin-3-yl)piperidine-4-carboxamide (PubChem CID 53203069) has the molecular formula C24H30N6O and a molecular weight of 418.55 g/mol. Its IUPAC name is N-[3-(3,4-dihydro-2H-quinolin-1-yl)propyl]-1-([1,2,4]triazolo[4,3-a]pyridin-3-yl)piperidine-4-carboxamide.
| Compound Name | N-[3-(3,4-dihydro-2H-quinolin-1-yl)propyl]-1-([1,2,4]triazolo[4,3-a]pyridin-3-yl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 53203069 |
| Molecular Formula | C24H30N6O |
| Molecular Weight | 418.55 g/mol |
| Exact Mass | 418.25 |
| IUPAC Name | N-[3-(3,4-dihydro-2H-quinolin-1-yl)propyl]-1-([1,2,4]triazolo[4,3-a]pyridin-3-yl)piperidine-4-carboxamide |
| SMILES | O=C(NCCCN1CCCc2ccccc21)C1CCN(c2nnc3ccccn23)CC1 |
| InChI | InChI=1S/C24H30N6O/c31-23(25-13-6-15-28-14-5-8-19-7-1-2-9-21(19)28)20-11-17-29(18-12-20)24-27-26-22-10-3-4-16-30(22)24/h1-4,7,9-10,16,20H,5-6,8,11-15,17-18H2,(H,25,31) |
| InChIKey | YIJDIIWAAHBAJO-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 65.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.55 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|