C25H32ClN3O — CID 125042887
(3S)-1-[(2-chlorophenyl)methyl]-N-[3-(3,4-dihydro-2H-quinolin-1-yl)propyl]piperidine-3-carboxamide (PubChem CID 125042887) has the molecular formula C25H32ClN3O and a molecular weight of 426.00 g/mol. Its IUPAC name is (3S)-1-[(2-chlorophenyl)methyl]-N-[3-(3,4-dihydro-2H-quinolin-1-yl)propyl]piperidine-3-carboxamide.
| Compound Name | (3S)-1-[(2-chlorophenyl)methyl]-N-[3-(3,4-dihydro-2H-quinolin-1-yl)propyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 125042887 |
| Molecular Formula | C25H32ClN3O |
| Molecular Weight | 426.00 g/mol |
| Exact Mass | 425.22 |
| IUPAC Name | (3S)-1-[(2-chlorophenyl)methyl]-N-[3-(3,4-dihydro-2H-quinolin-1-yl)propyl]piperidine-3-carboxamide |
| SMILES | O=C(NCCCN1CCCc2ccccc21)[C@H]1CCCN(Cc2ccccc2Cl)C1 |
| InChI | InChI=1S/C25H32ClN3O/c26-23-12-3-1-9-21(23)18-28-15-5-11-22(19-28)25(30)27-14-7-17-29-16-6-10-20-8-2-4-13-24(20)29/h1-4,8-9,12-13,22H,5-7,10-11,14-19H2,(H,27,30)/t22-/m0/s1 |
| InChIKey | SZEYBJUGBGQYNT-QFIPXVFZSA-N |
| XLogP | 4.51 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.00 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|