C27H33N5O4 — CID 86271515
4-[5-[(5-cyano-1H-imidazole-2-carbonyl)amino]-6-(2,3,6,6-tetradeuterio-4,4-dimethylcyclohexen-1-yl)-2-pyridinyl]-2,6,6-trimethyloxane-2-carboxylic acid (PubChem CID 86271515) has the molecular formula C27H33N5O4 and a molecular weight of 495.62 g/mol. Its IUPAC name is 4-[5-[(5-cyano-1H-imidazole-2-carbonyl)amino]-6-(2,3,6,6-tetradeuterio-4,4-dimethylcyclohexen-1-yl)-2-pyridinyl]-2,6,6-trimethyloxane-2-carboxylic acid.
| Compound Name | 4-[5-[(5-cyano-1H-imidazole-2-carbonyl)amino]-6-(2,3,6,6-tetradeuterio-4,4-dimethylcyclohexen-1-yl)-2-pyridinyl]-2,6,6-trimethyloxane-2-carboxylic acid |
|---|---|
| PubChem CID | 86271515 |
| Molecular Formula | C27H33N5O4 |
| Molecular Weight | 495.62 g/mol |
| Exact Mass | 495.28 |
| IUPAC Name | 4-[5-[(5-cyano-1H-imidazole-2-carbonyl)amino]-6-(2,3,6,6-tetradeuterio-4,4-dimethylcyclohexen-1-yl)-2-pyridinyl]-2,6,6-trimethyloxane-2-carboxylic acid |
| SMILES | [2H]C1=C(c2nc(C3CC(C)(C)OC(C)(C(=O)O)C3)ccc2NC(=O)c2ncc(C#N)[nH]2)C([2H])([2H])CC(C)(C)C1[2H] |
| InChI | InChI=1S/C27H33N5O4/c1-25(2)10-8-16(9-11-25)21-20(32-23(33)22-29-15-18(14-28)30-22)7-6-19(31-21)17-12-26(3,4)36-27(5,13-17)24(34)35/h6-8,15,17H,9-13H2,1-5H3,(H,29,30)(H,32,33)(H,34,35)/i8D,9D2,10D |
| InChIKey | MZZYKYGSHDFBTD-LRGHJICDSA-N |
| XLogP | 5.04 |
| TPSA | 140.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.62 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |