C25H30N2O2 — CID 86272787
[(2R)-1-[[5-(3-cyclopentyloxyphenyl)-1H-indol-2-yl]methyl]pyrrolidin-2-yl]methanol (PubChem CID 86272787) has the molecular formula C25H30N2O2 and a molecular weight of 390.53 g/mol. Its IUPAC name is [(2R)-1-[[5-(3-cyclopentyloxyphenyl)-1H-indol-2-yl]methyl]pyrrolidin-2-yl]methanol.
| Compound Name | [(2R)-1-[[5-(3-cyclopentyloxyphenyl)-1H-indol-2-yl]methyl]pyrrolidin-2-yl]methanol |
|---|---|
| PubChem CID | 86272787 |
| Molecular Formula | C25H30N2O2 |
| Molecular Weight | 390.53 g/mol |
| Exact Mass | 390.23 |
| IUPAC Name | [(2R)-1-[[5-(3-cyclopentyloxyphenyl)-1H-indol-2-yl]methyl]pyrrolidin-2-yl]methanol |
| SMILES | OC[C@H]1CCCN1Cc1cc2cc(-c3cccc(OC4CCCC4)c3)ccc2[nH]1 |
| InChI | InChI=1S/C25H30N2O2/c28-17-22-6-4-12-27(22)16-21-14-20-13-19(10-11-25(20)26-21)18-5-3-9-24(15-18)29-23-7-1-2-8-23/h3,5,9-11,13-15,22-23,26,28H,1-2,4,6-8,12,16-17H2/t22-/m1/s1 |
| InChIKey | SDXYRAOKJWZJBU-JOCHJYFZSA-N |
| XLogP | 5.11 |
| TPSA | 48.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.53 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |