C33H34BN3 — CID 86273447
[4-(1-benzyltriazol-4-yl)phenyl]-bis(2,4,6-trimethylphenyl)borane (PubChem CID 86273447) has the molecular formula C33H34BN3 and a molecular weight of 483.47 g/mol. Its IUPAC name is [4-(1-benzyltriazol-4-yl)phenyl]-bis(2,4,6-trimethylphenyl)borane.
| Compound Name | [4-(1-benzyltriazol-4-yl)phenyl]-bis(2,4,6-trimethylphenyl)borane |
|---|---|
| PubChem CID | 86273447 |
| Molecular Formula | C33H34BN3 |
| Molecular Weight | 483.47 g/mol |
| Exact Mass | 483.28 |
| IUPAC Name | [4-(1-benzyltriazol-4-yl)phenyl]-bis(2,4,6-trimethylphenyl)borane |
| SMILES | Cc1cc(C)c(B(c2ccc(-c3cn(Cc4ccccc4)nn3)cc2)c2c(C)cc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/C33H34BN3/c1-22-16-24(3)32(25(4)17-22)34(33-26(5)18-23(2)19-27(33)6)30-14-12-29(13-15-30)31-21-37(36-35-31)20-28-10-8-7-9-11-28/h7-19,21H,20H2,1-6H3 |
| InChIKey | BFPSSFPANHFKEI-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.47 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|