C32H40BN3O2Pt+2 — CID 86274639
4-hydroxypentan-2-one;[4-(1-methyltriazol-4-yl)phenyl]-bis(2,4,6-trimethylphenyl)borane;platinum(2+) (PubChem CID 86274639) has the molecular formula C32H40BN3O2Pt+2 and a molecular weight of 704.58 g/mol. Its IUPAC name is 4-hydroxypentan-2-one;[4-(1-methyltriazol-4-yl)phenyl]-bis(2,4,6-trimethylphenyl)borane;platinum(2+).
| Compound Name | 4-hydroxypentan-2-one;[4-(1-methyltriazol-4-yl)phenyl]-bis(2,4,6-trimethylphenyl)borane;platinum(2+) |
|---|---|
| PubChem CID | 86274639 |
| Molecular Formula | C32H40BN3O2Pt+2 |
| Molecular Weight | 704.58 g/mol |
| Exact Mass | 704.29 |
| IUPAC Name | 4-hydroxypentan-2-one;[4-(1-methyltriazol-4-yl)phenyl]-bis(2,4,6-trimethylphenyl)borane;platinum(2+) |
| SMILES | CC(=O)CC(C)O.Cc1cc(C)c(B(c2ccc(-c3cn(C)nn3)cc2)c2c(C)cc(C)cc2C)c(C)c1.[Pt+2] |
| InChI | InChI=1S/C27H30BN3.C5H10O2.Pt/c1-17-12-19(3)26(20(4)13-17)28(27-21(5)14-18(2)15-22(27)6)24-10-8-23(9-11-24)25-16-31(7)30-29-25;1-4(6)3-5(2)7;/h8-16H,1-7H3;4,6H,3H2,1-2H3;/q;;+2 |
| InChIKey | IUBSMTRAYLLRHT-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.58 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|